C32H44N4O3 — CID 69319135
(2S)-2-[3-(diethylamino)propanoylamino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide (PubChem CID 69319135) has the molecular formula C32H44N4O3 and a molecular weight of 532.73 g/mol. Its IUPAC name is (2S)-2-[3-(diethylamino)propanoylamino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide.
| Compound Name | (2S)-2-[3-(diethylamino)propanoylamino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide |
|---|---|
| PubChem CID | 69319135 |
| Molecular Formula | C32H44N4O3 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.34 |
| IUPAC Name | (2S)-2-[3-(diethylamino)propanoylamino]-8-oxo-N-[2-(2-phenyl-1H-indol-3-yl)ethyl]nonanamide |
| SMILES | CCN(CC)CCC(=O)N[C@@H](CCCCCC(C)=O)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C32H44N4O3/c1-4-36(5-2)23-21-30(38)34-29(19-11-6-8-14-24(3)37)32(39)33-22-20-27-26-17-12-13-18-28(26)35-31(27)25-15-9-7-10-16-25/h7,9-10,12-13,15-18,29,35H,4-6,8,11,14,19-23H2,1-3H3,(H,33,39)(H,34,38)/t29-/m0/s1 |
| InChIKey | AEDHBNFBQSMNDW-LJAQVGFWSA-N |
| XLogP | 5.25 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|