C30H38N4O4 — CID 69321018
N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]morpholine-2-carboxamide (PubChem CID 69321018) has the molecular formula C30H38N4O4 and a molecular weight of 518.66 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]morpholine-2-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 69321018 |
| Molecular Formula | C30H38N4O4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]morpholine-2-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1CNCCO1)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C30H38N4O4/c1-21(35)10-4-2-7-15-26(34-30(37)27-20-31-18-19-38-27)29(36)32-17-16-24-23-13-8-9-14-25(23)33-28(24)22-11-5-3-6-12-22/h3,5-6,8-9,11-14,26-27,31,33H,2,4,7,10,15-20H2,1H3,(H,32,36)(H,34,37)/t26-,27?/m0/s1 |
| InChIKey | LEOLCPHIZCWTTJ-QBHOUYDASA-N |
| XLogP | 3.51 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|