C36H42N4O3 — CID 69320836
N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 69320836) has the molecular formula C36H42N4O3 and a molecular weight of 578.76 g/mol. Its IUPAC name is N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 69320836 |
| Molecular Formula | C36H42N4O3 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | N-[(2S)-1,8-dioxo-1-[2-(2-phenyl-1H-indol-3-yl)ethylamino]nonan-2-yl]-2-methyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC(=O)CCCCC[C@H](NC(=O)C1Cc2ccccc2CN1C)C(=O)NCCc1c(-c2ccccc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C36H42N4O3/c1-25(41)13-5-3-8-20-32(39-36(43)33-23-27-16-9-10-17-28(27)24-40(33)2)35(42)37-22-21-30-29-18-11-12-19-31(29)38-34(30)26-14-6-4-7-15-26/h4,6-7,9-12,14-19,32-33,38H,3,5,8,13,20-24H2,1-2H3,(H,37,42)(H,39,43)/t32-,33?/m0/s1 |
| InChIKey | JINVCOHQESHVMK-JEFWXSHNSA-N |
| XLogP | 5.57 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|