C18H26O4 — CID 11232033
(3S,4E,6E)-9-(methoxymethoxy)-3-phenylmethoxynona-4,6-dien-1-ol (PubChem CID 11232033) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (3S,4E,6E)-9-(methoxymethoxy)-3-phenylmethoxynona-4,6-dien-1-ol.
| Compound Name | (3S,4E,6E)-9-(methoxymethoxy)-3-phenylmethoxynona-4,6-dien-1-ol |
|---|---|
| PubChem CID | 11232033 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (3S,4E,6E)-9-(methoxymethoxy)-3-phenylmethoxynona-4,6-dien-1-ol |
| SMILES | COCOCC/C=C/C=C/[C@H](CCO)OCc1ccccc1 |
| InChI | InChI=1S/C18H26O4/c1-20-16-21-14-8-3-2-7-11-18(12-13-19)22-15-17-9-5-4-6-10-17/h2-7,9-11,18-19H,8,12-16H2,1H3/b3-2+,11-7+/t18-/m1/s1 |
| InChIKey | RCSFFZUZDXUJTE-YDLBAZDGSA-N |
| XLogP | 3.08 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|