C15H20O4 — CID 71504858
(E,4S)-1-hydroxy-7-methoxy-4-phenylmethoxyhept-5-en-2-one (PubChem CID 71504858) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (E,4S)-1-hydroxy-7-methoxy-4-phenylmethoxyhept-5-en-2-one.
| Compound Name | (E,4S)-1-hydroxy-7-methoxy-4-phenylmethoxyhept-5-en-2-one |
|---|---|
| PubChem CID | 71504858 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (E,4S)-1-hydroxy-7-methoxy-4-phenylmethoxyhept-5-en-2-one |
| SMILES | COC/C=C/[C@H](CC(=O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C15H20O4/c1-18-9-5-8-15(10-14(17)11-16)19-12-13-6-3-2-4-7-13/h2-8,15-16H,9-12H2,1H3/b8-5+/t15-/m1/s1 |
| InChIKey | ADUAQPVCKUXFGF-SBJJXXPASA-N |
| XLogP | 1.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|