C23H28N2O6 — CID 71503561
5-formyl-N-methoxy-1-[(E,4S)-7-methoxy-2-oxo-4-phenylmethoxyhept-5-enyl]-N-methylpyrrole-2-carboxamide (PubChem CID 71503561) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 5-formyl-N-methoxy-1-[(E,4S)-7-methoxy-2-oxo-4-phenylmethoxyhept-5-enyl]-N-methylpyrrole-2-carboxamide.
| Compound Name | 5-formyl-N-methoxy-1-[(E,4S)-7-methoxy-2-oxo-4-phenylmethoxyhept-5-enyl]-N-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71503561 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-formyl-N-methoxy-1-[(E,4S)-7-methoxy-2-oxo-4-phenylmethoxyhept-5-enyl]-N-methylpyrrole-2-carboxamide |
| SMILES | COC/C=C/[C@H](CC(=O)Cn1c(C=O)ccc1C(=O)N(C)OC)OCc1ccccc1 |
| InChI | InChI=1S/C23H28N2O6/c1-24(30-3)23(28)22-12-11-19(16-26)25(22)15-20(27)14-21(10-7-13-29-2)31-17-18-8-5-4-6-9-18/h4-12,16,21H,13-15,17H2,1-3H3/b10-7+/t21-/m1/s1 |
| InChIKey | RHHBZOLSOCLJMA-TYOLEZHBSA-N |
| XLogP | 2.68 |
| TPSA | 87.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|