C20H33NO5 — CID 10248402
(2S,3R,5S)-N-methoxy-3-(methoxymethoxy)-N,2,6-trimethyl-5-phenylmethoxyheptanamide (PubChem CID 10248402) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is (2S,3R,5S)-N-methoxy-3-(methoxymethoxy)-N,2,6-trimethyl-5-phenylmethoxyheptanamide.
| Compound Name | (2S,3R,5S)-N-methoxy-3-(methoxymethoxy)-N,2,6-trimethyl-5-phenylmethoxyheptanamide |
|---|---|
| PubChem CID | 10248402 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (2S,3R,5S)-N-methoxy-3-(methoxymethoxy)-N,2,6-trimethyl-5-phenylmethoxyheptanamide |
| SMILES | COCO[C@H](C[C@H](OCc1ccccc1)C(C)C)[C@H](C)C(=O)N(C)OC |
| InChI | InChI=1S/C20H33NO5/c1-15(2)18(25-13-17-10-8-7-9-11-17)12-19(26-14-23-5)16(3)20(22)21(4)24-6/h7-11,15-16,18-19H,12-14H2,1-6H3/t16-,18-,19+/m0/s1 |
| InChIKey | BIVLUCJWVZHXRK-YTQUADARSA-N |
| XLogP | 3.26 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|