C27H47NO6Si — CID 102345387
[(2R,3R)-1-[methoxy(methyl)amino]-1-oxo-3-phenylmethoxy-4-tri(propan-2-yl)silyloxybutan-2-yl] 2,2-dimethylpropanoate (PubChem CID 102345387) has the molecular formula C27H47NO6Si and a molecular weight of 509.76 g/mol. Its IUPAC name is [(2R,3R)-1-[methoxy(methyl)amino]-1-oxo-3-phenylmethoxy-4-tri(propan-2-yl)silyloxybutan-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R)-1-[methoxy(methyl)amino]-1-oxo-3-phenylmethoxy-4-tri(propan-2-yl)silyloxybutan-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102345387 |
| Molecular Formula | C27H47NO6Si |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | [(2R,3R)-1-[methoxy(methyl)amino]-1-oxo-3-phenylmethoxy-4-tri(propan-2-yl)silyloxybutan-2-yl] 2,2-dimethylpropanoate |
| SMILES | CON(C)C(=O)[C@H](OC(=O)C(C)(C)C)[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C27H47NO6Si/c1-19(2)35(20(3)4,21(5)6)33-18-23(32-17-22-15-13-12-14-16-22)24(25(29)28(10)31-11)34-26(30)27(7,8)9/h12-16,19-21,23-24H,17-18H2,1-11H3/t23-,24-/m1/s1 |
| InChIKey | HSGWVADQYMWGAD-DNQXCXABSA-N |
| XLogP | 5.74 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|