C40H48O9 — CID 166953437
[2-[1-[bis(phenylmethoxy)methoxy]-2,2-bis(phenylmethoxy)ethoxy]-3-hydroxybutyl] 2,2-dimethylpropanoate (PubChem CID 166953437) has the molecular formula C40H48O9 and a molecular weight of 672.82 g/mol. Its IUPAC name is [2-[1-[bis(phenylmethoxy)methoxy]-2,2-bis(phenylmethoxy)ethoxy]-3-hydroxybutyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[1-[bis(phenylmethoxy)methoxy]-2,2-bis(phenylmethoxy)ethoxy]-3-hydroxybutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 166953437 |
| Molecular Formula | C40H48O9 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.33 |
| IUPAC Name | [2-[1-[bis(phenylmethoxy)methoxy]-2,2-bis(phenylmethoxy)ethoxy]-3-hydroxybutyl] 2,2-dimethylpropanoate |
| SMILES | CC(O)C(COC(=O)C(C)(C)C)OC(OC(OCc1ccccc1)OCc1ccccc1)C(OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C40H48O9/c1-30(41)35(29-45-38(42)40(2,3)4)48-37(36(43-25-31-17-9-5-10-18-31)44-26-32-19-11-6-12-20-32)49-39(46-27-33-21-13-7-14-22-33)47-28-34-23-15-8-16-24-34/h5-24,30,35-37,39,41H,25-29H2,1-4H3 |
| InChIKey | KEACQUQNAAZWKF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|