C18H24O5 — CID 10860183
[(2S,4R,5S)-4-hydroxy-3-methylidene-5-phenylmethoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10860183) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is [(2S,4R,5S)-4-hydroxy-3-methylidene-5-phenylmethoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2S,4R,5S)-4-hydroxy-3-methylidene-5-phenylmethoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10860183 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [(2S,4R,5S)-4-hydroxy-3-methylidene-5-phenylmethoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C1[C@@H](O)[C@@H](OCc2ccccc2)O[C@@H]1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H24O5/c1-12-14(11-22-17(20)18(2,3)4)23-16(15(12)19)21-10-13-8-6-5-7-9-13/h5-9,14-16,19H,1,10-11H2,2-4H3/t14-,15-,16+/m1/s1 |
| InChIKey | MSCOOMUBKVSEIQ-OAGGEKHMSA-N |
| XLogP | 2.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|