C37H53NO10Si — CID 10676199
1-O,2-O-dibenzyl 4-O-[(2R,3S)-2-methoxy-1-[methoxy(methyl)amino]-4-methyl-1-oxopentan-3-yl] (Z,3R)-1-methyl-3-triethylsilyloxybut-1-ene-1,2,4-tricarboxylate (PubChem CID 10676199) has the molecular formula C37H53NO10Si and a molecular weight of 699.91 g/mol. Its IUPAC name is 1-O,2-O-dibenzyl 4-O-[(2R,3S)-2-methoxy-1-[methoxy(methyl)amino]-4-methyl-1-oxopentan-3-yl] (Z,3R)-1-methyl-3-triethylsilyloxybut-1-ene-1,2,4-tricarboxylate.
| Compound Name | 1-O,2-O-dibenzyl 4-O-[(2R,3S)-2-methoxy-1-[methoxy(methyl)amino]-4-methyl-1-oxopentan-3-yl] (Z,3R)-1-methyl-3-triethylsilyloxybut-1-ene-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 10676199 |
| Molecular Formula | C37H53NO10Si |
| Molecular Weight | 699.91 g/mol |
| Exact Mass | 699.34 |
| IUPAC Name | 1-O,2-O-dibenzyl 4-O-[(2R,3S)-2-methoxy-1-[methoxy(methyl)amino]-4-methyl-1-oxopentan-3-yl] (Z,3R)-1-methyl-3-triethylsilyloxybut-1-ene-1,2,4-tricarboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H](CC(=O)O[C@@H](C(C)C)[C@@H](OC)C(=O)N(C)OC)/C(C(=O)OCc1ccccc1)=C(\C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C37H53NO10Si/c1-10-49(11-2,12-3)48-30(23-31(39)47-33(26(4)5)34(43-8)35(40)38(7)44-9)32(37(42)46-25-29-21-17-14-18-22-29)27(6)36(41)45-24-28-19-15-13-16-20-28/h13-22,26,30,33-34H,10-12,23-25H2,1-9H3/b32-27-/t30-,33+,34-/m1/s1 |
| InChIKey | WSLFNLPHQXKJSW-PDJRKKGTSA-N |
| XLogP | 6.17 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.91 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|