C38H57NO9 — CID 158981028
tert-butyl (3S)-3-formyl-6-phenylmethoxyhexanoate;tert-butyl (3S)-3-[methoxy(methyl)carbamoyl]-6-phenylmethoxyhexanoate (PubChem CID 158981028) has the molecular formula C38H57NO9 and a molecular weight of 671.87 g/mol. Its IUPAC name is tert-butyl (3S)-3-formyl-6-phenylmethoxyhexanoate;tert-butyl (3S)-3-[methoxy(methyl)carbamoyl]-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl (3S)-3-formyl-6-phenylmethoxyhexanoate;tert-butyl (3S)-3-[methoxy(methyl)carbamoyl]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 158981028 |
| Molecular Formula | C38H57NO9 |
| Molecular Weight | 671.87 g/mol |
| Exact Mass | 671.40 |
| IUPAC Name | tert-butyl (3S)-3-formyl-6-phenylmethoxyhexanoate;tert-butyl (3S)-3-[methoxy(methyl)carbamoyl]-6-phenylmethoxyhexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C=O)CCCOCc1ccccc1.CON(C)C(=O)[C@@H](CCCOCc1ccccc1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31NO5.C18H26O4/c1-20(2,3)26-18(22)14-17(19(23)21(4)24-5)12-9-13-25-15-16-10-7-6-8-11-16;1-18(2,3)22-17(20)12-16(13-19)10-7-11-21-14-15-8-5-4-6-9-15/h6-8,10-11,17H,9,12-15H2,1-5H3;4-6,8-9,13,16H,7,10-12,14H2,1-3H3/t17-;16-/m00/s1 |
| InChIKey | JOZSLYAUAZXQTH-KLTJRSTASA-N |
| XLogP | 6.88 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.87 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|