C46H61NO11 — CID 161389702
tert-butyl 3-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-6-phenylmethoxyhexanoate;2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-phenylmethoxypentanoic acid (PubChem CID 161389702) has the molecular formula C46H61NO11 and a molecular weight of 803.99 g/mol. Its IUPAC name is tert-butyl 3-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-6-phenylmethoxyhexanoate;2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-phenylmethoxypentanoic acid.
| Compound Name | tert-butyl 3-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-6-phenylmethoxyhexanoate;2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-phenylmethoxypentanoic acid |
|---|---|
| PubChem CID | 161389702 |
| Molecular Formula | C46H61NO11 |
| Molecular Weight | 803.99 g/mol |
| Exact Mass | 803.42 |
| IUPAC Name | tert-butyl 3-[(4R)-4-benzyl-2-oxo-1,3-oxazolidine-3-carbonyl]-6-phenylmethoxyhexanoate;2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-5-phenylmethoxypentanoic acid |
| SMILES | CC(C)(C)OC(=O)CC(CCCOCc1ccccc1)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1.CC(C)(C)OC(=O)CC(CCCOCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C28H35NO6.C18H26O5/c1-28(2,3)35-25(30)18-23(15-10-16-33-19-22-13-8-5-9-14-22)26(31)29-24(20-34-27(29)32)17-21-11-6-4-7-12-21;1-18(2,3)23-16(19)12-15(17(20)21)10-7-11-22-13-14-8-5-4-6-9-14/h4-9,11-14,23-24H,10,15-20H2,1-3H3;4-6,8-9,15H,7,10-13H2,1-3H3,(H,20,21)/t23?,24-;/m1./s1 |
| InChIKey | VSVBGBOQZNYOID-RETUOTIWSA-N |
| XLogP | 8.34 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.99 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|