C21H27IN2O5 — CID 137216403
tert-butyl (3S)-3-[5-(hydroxyiminomethyl)-4-iodo-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate (PubChem CID 137216403) has the molecular formula C21H27IN2O5 and a molecular weight of 514.36 g/mol. Its IUPAC name is tert-butyl (3S)-3-[5-(hydroxyiminomethyl)-4-iodo-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl (3S)-3-[5-(hydroxyiminomethyl)-4-iodo-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 137216403 |
| Molecular Formula | C21H27IN2O5 |
| Molecular Weight | 514.36 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | tert-butyl (3S)-3-[5-(hydroxyiminomethyl)-4-iodo-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CCCOCc1ccccc1)c1noc(C=NO)c1I |
| InChI | InChI=1S/C21H27IN2O5/c1-21(2,3)28-18(25)12-16(20-19(22)17(13-23-26)29-24-20)10-7-11-27-14-15-8-5-4-6-9-15/h4-6,8-9,13,16,26H,7,10-12,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | FLOJRUYJKQQLAY-INIZCTEOSA-N |
| XLogP | 4.90 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|