C30H45NO5 — CID 121340419
tert-butyl (3S)-3-[5-[3-(3-methoxy-2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate (PubChem CID 121340419) has the molecular formula C30H45NO5 and a molecular weight of 499.69 g/mol. Its IUPAC name is tert-butyl (3S)-3-[5-[3-(3-methoxy-2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl (3S)-3-[5-[3-(3-methoxy-2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 121340419 |
| Molecular Formula | C30H45NO5 |
| Molecular Weight | 499.69 g/mol |
| Exact Mass | 499.33 |
| IUPAC Name | tert-butyl (3S)-3-[5-[3-(3-methoxy-2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
| SMILES | COCC(C)(C)CC1CC(c2cc([C@@H](CCCOCc3ccccc3)CC(=O)OC(C)(C)C)no2)C1 |
| InChI | InChI=1S/C30H45NO5/c1-29(2,3)35-28(32)17-24(13-10-14-34-20-22-11-8-7-9-12-22)26-18-27(36-31-26)25-15-23(16-25)19-30(4,5)21-33-6/h7-9,11-12,18,23-25H,10,13-17,19-21H2,1-6H3/t23?,24-,25?/m0/s1 |
| InChIKey | IMEZBHXPUANPGD-BQCMWAFGSA-N |
| XLogP | 7.04 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.69 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|