C27H43NO5Si — CID 131747746
tert-butyl (3S)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoate (PubChem CID 131747746) has the molecular formula C27H43NO5Si and a molecular weight of 489.73 g/mol. Its IUPAC name is tert-butyl (3S)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl (3S)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 131747746 |
| Molecular Formula | C27H43NO5Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | tert-butyl (3S)-3-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CCCOCc1ccccc1)c1cc(CO[Si](C)(C)C(C)(C)C)no1 |
| InChI | InChI=1S/C27H43NO5Si/c1-26(2,3)32-25(29)17-22(15-12-16-30-19-21-13-10-9-11-14-21)24-18-23(28-33-24)20-31-34(7,8)27(4,5)6/h9-11,13-14,18,22H,12,15-17,19-20H2,1-8H3/t22-/m0/s1 |
| InChIKey | IMSKREJWYZCFQE-QFIPXVFZSA-N |
| XLogP | 7.01 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|