C24H33NO5 — CID 121340121
tert-butyl (3S)-3-[4-cyclopropyl-5-(hydroxymethyl)-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate (PubChem CID 121340121) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-cyclopropyl-5-(hydroxymethyl)-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl (3S)-3-[4-cyclopropyl-5-(hydroxymethyl)-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 121340121 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | tert-butyl (3S)-3-[4-cyclopropyl-5-(hydroxymethyl)-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CCCOCc1ccccc1)c1noc(CO)c1C1CC1 |
| InChI | InChI=1S/C24H33NO5/c1-24(2,3)29-21(27)14-19(10-7-13-28-16-17-8-5-4-6-9-17)23-22(18-11-12-18)20(15-26)30-25-23/h4-6,8-9,18-19,26H,7,10-16H2,1-3H3/t19-/m0/s1 |
| InChIKey | SSGKIQHSOAVWQP-IBGZPJMESA-N |
| XLogP | 4.86 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|