C33H51N3O3 — CID 121340340
tert-butyl (3S)-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]-6-phenylmethoxyhexanoate (PubChem CID 121340340) has the molecular formula C33H51N3O3 and a molecular weight of 537.79 g/mol. Its IUPAC name is tert-butyl (3S)-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl (3S)-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 121340340 |
| Molecular Formula | C33H51N3O3 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.39 |
| IUPAC Name | tert-butyl (3S)-3-[5-cyclopropyl-1-[3-(2,2,3-trimethylbutyl)cyclobutyl]triazol-4-yl]-6-phenylmethoxyhexanoate |
| SMILES | CC(C)C(C)(C)CC1CC(n2nnc([C@@H](CCCOCc3ccccc3)CC(=O)OC(C)(C)C)c2C2CC2)C1 |
| InChI | InChI=1S/C33H51N3O3/c1-23(2)33(6,7)21-25-18-28(19-25)36-31(26-15-16-26)30(34-35-36)27(20-29(37)39-32(3,4)5)14-11-17-38-22-24-12-9-8-10-13-24/h8-10,12-13,23,25-28H,11,14-22H2,1-7H3/t25?,27-,28?/m0/s1 |
| InChIKey | CRJFHFAKJTWBGE-QLADNINMSA-N |
| XLogP | 7.99 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|