C25H35NO4 — CID 121333684
(3S)-3-[3-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid (PubChem CID 121333684) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is (3S)-3-[3-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid.
| Compound Name | (3S)-3-[3-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 121333684 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | (3S)-3-[3-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid |
| SMILES | CC(C)(C)CC1CC(c2cc([C@@H](CCCOCc3ccccc3)CC(=O)O)on2)C1 |
| InChI | InChI=1S/C25H35NO4/c1-25(2,3)16-19-12-21(13-19)22-15-23(30-26-22)20(14-24(27)28)10-7-11-29-17-18-8-5-4-6-9-18/h4-6,8-9,15,19-21H,7,10-14,16-17H2,1-3H3,(H,27,28)/t19?,20-,21?/m0/s1 |
| InChIKey | WYTMSCMUYMJCEL-KBWCOIMZSA-N |
| XLogP | 6.16 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|