C17H20INO5 — CID 121333698
3-[3-(hydroxymethyl)-4-iodo-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid (PubChem CID 121333698) has the molecular formula C17H20INO5 and a molecular weight of 445.25 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)-4-iodo-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid.
| Compound Name | 3-[3-(hydroxymethyl)-4-iodo-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 121333698 |
| Molecular Formula | C17H20INO5 |
| Molecular Weight | 445.25 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 3-[3-(hydroxymethyl)-4-iodo-1,2-oxazol-5-yl]-6-phenylmethoxyhexanoic acid |
| SMILES | O=C(O)CC(CCCOCc1ccccc1)c1onc(CO)c1I |
| InChI | InChI=1S/C17H20INO5/c18-16-14(10-20)19-24-17(16)13(9-15(21)22)7-4-8-23-11-12-5-2-1-3-6-12/h1-3,5-6,13,20H,4,7-11H2,(H,21,22) |
| InChIKey | DXAQITOIPCGSFJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|