C26H30N2O6 — CID 121333575
(3S)-3-[5-[5-(2,2-dimethylpropanoyl)-1,2-oxazol-3-yl]-4-ethenyl-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoic acid (PubChem CID 121333575) has the molecular formula C26H30N2O6 and a molecular weight of 466.53 g/mol. Its IUPAC name is (3S)-3-[5-[5-(2,2-dimethylpropanoyl)-1,2-oxazol-3-yl]-4-ethenyl-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoic acid.
| Compound Name | (3S)-3-[5-[5-(2,2-dimethylpropanoyl)-1,2-oxazol-3-yl]-4-ethenyl-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 121333575 |
| Molecular Formula | C26H30N2O6 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (3S)-3-[5-[5-(2,2-dimethylpropanoyl)-1,2-oxazol-3-yl]-4-ethenyl-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoic acid |
| SMILES | C=Cc1c([C@@H](CCCOCc2ccccc2)CC(=O)O)noc1-c1cc(C(=O)C(C)(C)C)on1 |
| InChI | InChI=1S/C26H30N2O6/c1-5-19-23(28-34-24(19)20-15-21(33-27-20)25(31)26(2,3)4)18(14-22(29)30)12-9-13-32-16-17-10-7-6-8-11-17/h5-8,10-11,15,18H,1,9,12-14,16H2,2-4H3,(H,29,30)/t18-/m0/s1 |
| InChIKey | JAFRTQMWPRUXTI-SFHVURJKSA-N |
| XLogP | 5.76 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|