C17H18INO5 — CID 121333593
(3S)-3-(3-formyl-4-iodo-1,2-oxazol-5-yl)-6-phenylmethoxyhexanoic acid (PubChem CID 121333593) has the molecular formula C17H18INO5 and a molecular weight of 443.24 g/mol. Its IUPAC name is (3S)-3-(3-formyl-4-iodo-1,2-oxazol-5-yl)-6-phenylmethoxyhexanoic acid.
| Compound Name | (3S)-3-(3-formyl-4-iodo-1,2-oxazol-5-yl)-6-phenylmethoxyhexanoic acid |
|---|---|
| PubChem CID | 121333593 |
| Molecular Formula | C17H18INO5 |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | (3S)-3-(3-formyl-4-iodo-1,2-oxazol-5-yl)-6-phenylmethoxyhexanoic acid |
| SMILES | O=Cc1noc([C@@H](CCCOCc2ccccc2)CC(=O)O)c1I |
| InChI | InChI=1S/C17H18INO5/c18-16-14(10-20)19-24-17(16)13(9-15(21)22)7-4-8-23-11-12-5-2-1-3-6-12/h1-3,5-6,10,13H,4,7-9,11H2,(H,21,22)/t13-/m0/s1 |
| InChIKey | OHOPZPZEWPFMFF-ZDUSSCGKSA-N |
| XLogP | 3.65 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|