C14H15NO3 — CID 134390229
5-(3-phenylmethoxypropyl)-1,2-oxazole-3-carbaldehyde (PubChem CID 134390229) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 5-(3-phenylmethoxypropyl)-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-(3-phenylmethoxypropyl)-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 134390229 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 5-(3-phenylmethoxypropyl)-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1cc(CCCOCc2ccccc2)on1 |
| InChI | InChI=1S/C14H15NO3/c16-10-13-9-14(18-15-13)7-4-8-17-11-12-5-2-1-3-6-12/h1-3,5-6,9-10H,4,7-8,11H2 |
| InChIKey | FQCCTUSRCZOCEZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|