C37H48N2O8 — CID 122365731
(4-nitrophenyl)methyl 5-[3-(2,2-dimethylpropyl)cyclobutyl]-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-phenylmethoxyhexan-3-yl]-1,2-oxazole-4-carboxylate (PubChem CID 122365731) has the molecular formula C37H48N2O8 and a molecular weight of 648.80 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 5-[3-(2,2-dimethylpropyl)cyclobutyl]-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-phenylmethoxyhexan-3-yl]-1,2-oxazole-4-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 5-[3-(2,2-dimethylpropyl)cyclobutyl]-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-phenylmethoxyhexan-3-yl]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 122365731 |
| Molecular Formula | C37H48N2O8 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.34 |
| IUPAC Name | (4-nitrophenyl)methyl 5-[3-(2,2-dimethylpropyl)cyclobutyl]-3-[1-[(2-methylpropan-2-yl)oxy]-1-oxo-6-phenylmethoxyhexan-3-yl]-1,2-oxazole-4-carboxylate |
| SMILES | CC(C)(C)CC1CC(c2onc(C(CCCOCc3ccccc3)CC(=O)OC(C)(C)C)c2C(=O)OCc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C37H48N2O8/c1-36(2,3)22-27-19-29(20-27)34-32(35(41)45-24-26-14-16-30(17-15-26)39(42)43)33(38-47-34)28(21-31(40)46-37(4,5)6)13-10-18-44-23-25-11-8-7-9-12-25/h7-9,11-12,14-17,27-29H,10,13,18-24H2,1-6H3 |
| InChIKey | ZTLIGZFWEKUBCP-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 131.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|