C30H40N2O5 — CID 121340172
tert-butyl (3S)-3-[4-cyclopropyl-5-[5-(2-methylpropyl)-1,3-oxazol-2-yl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate (PubChem CID 121340172) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is tert-butyl (3S)-3-[4-cyclopropyl-5-[5-(2-methylpropyl)-1,3-oxazol-2-yl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate.
| Compound Name | tert-butyl (3S)-3-[4-cyclopropyl-5-[5-(2-methylpropyl)-1,3-oxazol-2-yl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
|---|---|
| PubChem CID | 121340172 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | tert-butyl (3S)-3-[4-cyclopropyl-5-[5-(2-methylpropyl)-1,3-oxazol-2-yl]-1,2-oxazol-3-yl]-6-phenylmethoxyhexanoate |
| SMILES | CC(C)Cc1cnc(-c2onc([C@@H](CCCOCc3ccccc3)CC(=O)OC(C)(C)C)c2C2CC2)o1 |
| InChI | InChI=1S/C30H40N2O5/c1-20(2)16-24-18-31-29(35-24)28-26(22-13-14-22)27(32-37-28)23(17-25(33)36-30(3,4)5)12-9-15-34-19-21-10-7-6-8-11-21/h6-8,10-11,18,20,22-23H,9,12-17,19H2,1-5H3/t23-/m0/s1 |
| InChIKey | WBVNRRFHMTZOQI-QHCPKHFHSA-N |
| XLogP | 7.22 |
| TPSA | 87.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|