C22H31N3O3 — CID 121340333
tert-butyl (3S)-3-[5-cyclopropyl-1-(4-methylphenyl)triazol-4-yl]-6-hydroxyhexanoate (PubChem CID 121340333) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl (3S)-3-[5-cyclopropyl-1-(4-methylphenyl)triazol-4-yl]-6-hydroxyhexanoate.
| Compound Name | tert-butyl (3S)-3-[5-cyclopropyl-1-(4-methylphenyl)triazol-4-yl]-6-hydroxyhexanoate |
|---|---|
| PubChem CID | 121340333 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl (3S)-3-[5-cyclopropyl-1-(4-methylphenyl)triazol-4-yl]-6-hydroxyhexanoate |
| SMILES | Cc1ccc(-n2nnc([C@@H](CCCO)CC(=O)OC(C)(C)C)c2C2CC2)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-15-7-11-18(12-8-15)25-21(16-9-10-16)20(23-24-25)17(6-5-13-26)14-19(27)28-22(2,3)4/h7-8,11-12,16-17,26H,5-6,9-10,13-14H2,1-4H3/t17-/m0/s1 |
| InChIKey | HNFIFHPSKTWLLR-KRWDZBQOSA-N |
| XLogP | 4.04 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |