C22H30N4O2 — CID 86972051
N-(2-cycloheptyloxyethyl)-5-cyclopropyl-1-(4-methylphenyl)triazole-4-carboxamide (PubChem CID 86972051) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-(2-cycloheptyloxyethyl)-5-cyclopropyl-1-(4-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-(2-cycloheptyloxyethyl)-5-cyclopropyl-1-(4-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 86972051 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-(2-cycloheptyloxyethyl)-5-cyclopropyl-1-(4-methylphenyl)triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2nnc(C(=O)NCCOC3CCCCCC3)c2C2CC2)cc1 |
| InChI | InChI=1S/C22H30N4O2/c1-16-8-12-18(13-9-16)26-21(17-10-11-17)20(24-25-26)22(27)23-14-15-28-19-6-4-2-3-5-7-19/h8-9,12-13,17,19H,2-7,10-11,14-15H2,1H3,(H,23,27) |
| InChIKey | VIWGEBFBNPUCIX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|