C14H16FN5O3S — CID 51130190
5-cyclopropyl-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)triazole-4-carboxamide (PubChem CID 51130190) has the molecular formula C14H16FN5O3S and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-cyclopropyl-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)triazole-4-carboxamide.
| Compound Name | 5-cyclopropyl-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 51130190 |
| Molecular Formula | C14H16FN5O3S |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 5-cyclopropyl-1-(4-fluorophenyl)-N-(2-sulfamoylethyl)triazole-4-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1nnn(-c2ccc(F)cc2)c1C1CC1 |
| InChI | InChI=1S/C14H16FN5O3S/c15-10-3-5-11(6-4-10)20-13(9-1-2-9)12(18-19-20)14(21)17-7-8-24(16,22)23/h3-6,9H,1-2,7-8H2,(H,17,21)(H2,16,22,23) |
| InChIKey | DXKHKGLTXXGSQY-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |