C16H21BrClN5O — CID 119509493
1-(4-bromophenyl)-5-cyclopropyl-N-[2-(ethylamino)ethyl]triazole-4-carboxamide;hydrochloride (PubChem CID 119509493) has the molecular formula C16H21BrClN5O and a molecular weight of 414.74 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-cyclopropyl-N-[2-(ethylamino)ethyl]triazole-4-carboxamide;hydrochloride.
| Compound Name | 1-(4-bromophenyl)-5-cyclopropyl-N-[2-(ethylamino)ethyl]triazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119509493 |
| Molecular Formula | C16H21BrClN5O |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 1-(4-bromophenyl)-5-cyclopropyl-N-[2-(ethylamino)ethyl]triazole-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1nnn(-c2ccc(Br)cc2)c1C1CC1.Cl |
| InChI | InChI=1S/C16H20BrN5O.ClH/c1-2-18-9-10-19-16(23)14-15(11-3-4-11)22(21-20-14)13-7-5-12(17)6-8-13;/h5-8,11,18H,2-4,9-10H2,1H3,(H,19,23);1H |
| InChIKey | HOVMPGYZENNJPN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|