About tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate
tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate (PubChem CID 71127364) has the molecular formula C22H37NO4
and a molecular weight of 379.54 g/mol. Its IUPAC name is tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate |
| PubChem CID | 71127364 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate |
| SMILES | CC(C)(C)CCCc1onc(C(CCO)CC(=O)OC(C)(C)C)c1C1CC1 |
| InChI | InChI=1S/C22H37NO4/c1-21(2,3)12-7-8-17-19(15-9-10-15)20(23-27-17)16(11-13-24)14-18(25)26-22(4,5)6/h15-16,24H,7-14H2,1-6H3 |
| InChIKey | RPHRTHIZKHFNBN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate?
The IUPAC name of tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate (CID 71127364) is tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate.
What is the SMILES notation for tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate?
The canonical SMILES for tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate is CC(C)(C)CCCc1onc(C(CCO)CC(=O)OC(C)(C)C)c1C1CC1.
What is the InChIKey of tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate?
The InChIKey is RPHRTHIZKHFNBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37NO4/c1-21(2,3)12-7-8-17-19(15-9-10-15)20(23-27-17)16(11-13-24)14-18(25)26-22(4,5)6/h15-16,24H,7-14H2,1-6H3.
What are the key properties of tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate?
tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate has a molecular weight of 379.54 g/mol, XLogP of 5.12, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[4-cyclopropyl-5-(4,4-dimethylpentyl)-1,2-oxazol-3-yl]-5-hydroxypentanoate is sourced from PubChem (CID 71127364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).