C24H32O4 — CID 101412939
(3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-methyl-1-phenylnonan-2-one (PubChem CID 101412939) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-methyl-1-phenylnonan-2-one.
| Compound Name | (3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-methyl-1-phenylnonan-2-one |
|---|---|
| PubChem CID | 101412939 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (3R,7S)-3-hydroxy-7-[(4-methoxyphenyl)methoxy]-8-methyl-1-phenylnonan-2-one |
| SMILES | COc1ccc(CO[C@@H](CCC[C@@H](O)C(=O)Cc2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C24H32O4/c1-18(2)24(28-17-20-12-14-21(27-3)15-13-20)11-7-10-22(25)23(26)16-19-8-5-4-6-9-19/h4-6,8-9,12-15,18,22,24-25H,7,10-11,16-17H2,1-3H3/t22-,24+/m1/s1 |
| InChIKey | RNXDSTUFORMONP-VWNXMTODSA-N |
| XLogP | 4.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |