C28H42O8 — CID 11124015
(E,4R)-4-[(1R,2S,4S)-2-[(E,6S)-6-hydroxyhept-1-enyl]-4-(2-methoxyethoxymethoxy)cyclopentyl]-4-[(4-methoxyphenyl)methoxy]but-2-enoic acid (PubChem CID 11124015) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is (E,4R)-4-[(1R,2S,4S)-2-[(E,6S)-6-hydroxyhept-1-enyl]-4-(2-methoxyethoxymethoxy)cyclopentyl]-4-[(4-methoxyphenyl)methoxy]but-2-enoic acid.
| Compound Name | (E,4R)-4-[(1R,2S,4S)-2-[(E,6S)-6-hydroxyhept-1-enyl]-4-(2-methoxyethoxymethoxy)cyclopentyl]-4-[(4-methoxyphenyl)methoxy]but-2-enoic acid |
|---|---|
| PubChem CID | 11124015 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (E,4R)-4-[(1R,2S,4S)-2-[(E,6S)-6-hydroxyhept-1-enyl]-4-(2-methoxyethoxymethoxy)cyclopentyl]-4-[(4-methoxyphenyl)methoxy]but-2-enoic acid |
| SMILES | COCCOCO[C@@H]1C[C@@H]([C@@H](/C=C/C(=O)O)OCc2ccc(OC)cc2)[C@H](/C=C/CCC[C@H](C)O)C1 |
| InChI | InChI=1S/C28H42O8/c1-21(29)7-5-4-6-8-23-17-25(36-20-34-16-15-32-2)18-26(23)27(13-14-28(30)31)35-19-22-9-11-24(33-3)12-10-22/h6,8-14,21,23,25-27,29H,4-5,7,15-20H2,1-3H3,(H,30,31)/b8-6+,14-13+/t21-,23+,25-,26+,27+/m0/s1 |
| InChIKey | NJZWPLWWBUSYMC-DMBSAINLSA-N |
| XLogP | 4.36 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|