C16H22O6 — CID 101373892
methyl (2R,3S,5R)-3-hydroxy-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolane-2-carboxylate (PubChem CID 101373892) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl (2R,3S,5R)-3-hydroxy-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolane-2-carboxylate.
| Compound Name | methyl (2R,3S,5R)-3-hydroxy-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolane-2-carboxylate |
|---|---|
| PubChem CID | 101373892 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl (2R,3S,5R)-3-hydroxy-5-[2-[(4-methoxyphenyl)methoxy]ethyl]oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H](CCOCc2ccc(OC)cc2)C[C@@H]1O |
| InChI | InChI=1S/C16H22O6/c1-19-12-5-3-11(4-6-12)10-21-8-7-13-9-14(17)15(22-13)16(18)20-2/h3-6,13-15,17H,7-10H2,1-2H3/t13-,14+,15-/m1/s1 |
| InChIKey | FRHFJBZGARCJRW-QLFBSQMISA-N |
| XLogP | 1.29 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|