C25H32N2O7S — CID 69281332
methyl (2S,3S,4R,6R)-3,4-bis[(4-methoxyphenyl)methoxy]-6-(N'-methylcarbamimidoyl)sulfanyloxane-2-carboxylate (PubChem CID 69281332) has the molecular formula C25H32N2O7S and a molecular weight of 504.61 g/mol. Its IUPAC name is methyl (2S,3S,4R,6R)-3,4-bis[(4-methoxyphenyl)methoxy]-6-(N'-methylcarbamimidoyl)sulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,6R)-3,4-bis[(4-methoxyphenyl)methoxy]-6-(N'-methylcarbamimidoyl)sulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 69281332 |
| Molecular Formula | C25H32N2O7S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | methyl (2S,3S,4R,6R)-3,4-bis[(4-methoxyphenyl)methoxy]-6-(N'-methylcarbamimidoyl)sulfanyloxane-2-carboxylate |
| SMILES | C/N=C(\N)S[C@@H]1C[C@@H](OCc2ccc(OC)cc2)[C@H](OCc2ccc(OC)cc2)[C@@H](C(=O)OC)O1 |
| InChI | InChI=1S/C25H32N2O7S/c1-27-25(26)35-21-13-20(32-14-16-5-9-18(29-2)10-6-16)22(23(34-21)24(28)31-4)33-15-17-7-11-19(30-3)12-8-17/h5-12,20-23H,13-15H2,1-4H3,(H2,26,27)/t20-,21-,22+,23+/m1/s1 |
| InChIKey | ZWBQXWFBJSGYGB-LUKWVAJMSA-N |
| XLogP | 3.14 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|