C17H26N2O4S — CID 144656588
[(2R,5S)-4,5-dihydroxy-6-[3-(4-methoxyphenyl)propyl]oxan-2-yl] N'-methylcarbamimidothioate (PubChem CID 144656588) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is [(2R,5S)-4,5-dihydroxy-6-[3-(4-methoxyphenyl)propyl]oxan-2-yl] N'-methylcarbamimidothioate.
| Compound Name | [(2R,5S)-4,5-dihydroxy-6-[3-(4-methoxyphenyl)propyl]oxan-2-yl] N'-methylcarbamimidothioate |
|---|---|
| PubChem CID | 144656588 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | [(2R,5S)-4,5-dihydroxy-6-[3-(4-methoxyphenyl)propyl]oxan-2-yl] N'-methylcarbamimidothioate |
| SMILES | C/N=C(\N)S[C@@H]1CC(O)[C@H](O)C(CCCc2ccc(OC)cc2)O1 |
| InChI | InChI=1S/C17H26N2O4S/c1-19-17(18)24-15-10-13(20)16(21)14(23-15)5-3-4-11-6-8-12(22-2)9-7-11/h6-9,13-16,20-21H,3-5,10H2,1-2H3,(H2,18,19)/t13?,14?,15-,16+/m1/s1 |
| InChIKey | WIDHZMXKKYTVOC-FJBKBRRZSA-N |
| XLogP | 1.53 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|