C26H38O9 — CID 69135577
(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;1-methoxy-4-[3-[3-(4-methoxyphenyl)propoxy]propyl]benzene (PubChem CID 69135577) has the molecular formula C26H38O9 and a molecular weight of 494.58 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;1-methoxy-4-[3-[3-(4-methoxyphenyl)propoxy]propyl]benzene.
| Compound Name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;1-methoxy-4-[3-[3-(4-methoxyphenyl)propoxy]propyl]benzene |
|---|---|
| PubChem CID | 69135577 |
| Molecular Formula | C26H38O9 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;1-methoxy-4-[3-[3-(4-methoxyphenyl)propoxy]propyl]benzene |
| SMILES | COc1ccc(CCCOCCCc2ccc(OC)cc2)cc1.OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H26O3.C6H12O6/c1-21-19-11-7-17(8-12-19)5-3-15-23-16-4-6-18-9-13-20(22-2)14-10-18;7-1-2-3(8)4(9)5(10)6(11)12-2/h7-14H,3-6,15-16H2,1-2H3;2-11H,1H2/t;2-,3-,4+,5-,6?/m.1/s1 |
| InChIKey | XFYHEOGZJGJJJD-MSPHXDAXSA-N |
| XLogP | 1.06 |
| TPSA | 138.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|