C20H30O7 — CID 101141956
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,2S)-2-[(4-methoxyphenyl)methyl]cyclohexyl]oxyoxane-3,4,5-triol (PubChem CID 101141956) has the molecular formula C20H30O7 and a molecular weight of 382.45 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,2S)-2-[(4-methoxyphenyl)methyl]cyclohexyl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,2S)-2-[(4-methoxyphenyl)methyl]cyclohexyl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 101141956 |
| Molecular Formula | C20H30O7 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(1R,2S)-2-[(4-methoxyphenyl)methyl]cyclohexyl]oxyoxane-3,4,5-triol |
| SMILES | COc1ccc(C[C@@H]2CCCC[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H30O7/c1-25-14-8-6-12(7-9-14)10-13-4-2-3-5-15(13)26-20-19(24)18(23)17(22)16(11-21)27-20/h6-9,13,15-24H,2-5,10-11H2,1H3/t13-,15+,16+,17+,18-,19+,20+/m0/s1 |
| InChIKey | HEARZXNFASLDLW-LAWNSHMXSA-N |
| XLogP | 0.61 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |