C16H25NO7 — CID 146735029
2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methylamino]ethoxy]oxane-3,4,5-triol (PubChem CID 146735029) has the molecular formula C16H25NO7 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methylamino]ethoxy]oxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methylamino]ethoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 146735029 |
| Molecular Formula | C16H25NO7 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 2-(hydroxymethyl)-6-[2-[(4-methoxyphenyl)methylamino]ethoxy]oxane-3,4,5-triol |
| SMILES | COc1ccc(CNCCOC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C16H25NO7/c1-22-11-4-2-10(3-5-11)8-17-6-7-23-16-15(21)14(20)13(19)12(9-18)24-16/h2-5,12-21H,6-9H2,1H3 |
| InChIKey | RIZNQMJVPZSTNH-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 120.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|