C22H27NO8 — CID 10203155
N-[(4-methoxyphenyl)methyl]-2-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide (PubChem CID 10203155) has the molecular formula C22H27NO8 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 10203155 |
| Molecular Formula | C22H27NO8 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-methyl-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybenzamide |
| SMILES | COc1ccc(CNC(=O)c2c(C)cccc2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C22H27NO8/c1-12-4-3-5-15(30-22-20(27)19(26)18(25)16(11-24)31-22)17(12)21(28)23-10-13-6-8-14(29-2)9-7-13/h3-9,16,18-20,22,24-27H,10-11H2,1-2H3,(H,23,28)/t16-,18-,19+,20-,22-/m1/s1 |
| InChIKey | WMTLGEUZNMUWIW-QKYBYQKWSA-N |
| XLogP | 0.11 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |