C34H34O7S — CID 132933787
(2S,3S,4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylic acid (PubChem CID 132933787) has the molecular formula C34H34O7S and a molecular weight of 586.71 g/mol. Its IUPAC name is (2S,3S,4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 132933787 |
| Molecular Formula | C34H34O7S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | (2S,3S,4S,5S,6R)-5-[(4-methoxyphenyl)methoxy]-3,4-bis(phenylmethoxy)-6-phenylsulfanyloxane-2-carboxylic acid |
| SMILES | COc1ccc(CO[C@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](C(=O)O)O[C@@H]2Sc2ccccc2)cc1 |
| InChI | InChI=1S/C34H34O7S/c1-37-27-19-17-26(18-20-27)23-40-32-30(39-22-25-13-7-3-8-14-25)29(38-21-24-11-5-2-6-12-24)31(33(35)36)41-34(32)42-28-15-9-4-10-16-28/h2-20,29-32,34H,21-23H2,1H3,(H,35,36)/t29-,30-,31-,32-,34+/m0/s1 |
| InChIKey | VKGBNSHNRDXMHR-DLRNAMLRSA-N |
| XLogP | 6.35 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |