C28H28O6S — CID 71613613
[(2S,3S,4S,5S,6R)-2-formyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 71613613) has the molecular formula C28H28O6S and a molecular weight of 492.59 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6R)-2-formyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5S,6R)-2-formyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 71613613 |
| Molecular Formula | C28H28O6S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [(2S,3S,4S,5S,6R)-2-formyl-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](Sc2ccccc2)O[C@@H]1C=O |
| InChI | InChI=1S/C28H28O6S/c1-20(30)33-25-24(17-29)34-28(35-23-15-9-4-10-16-23)27(32-19-22-13-7-3-8-14-22)26(25)31-18-21-11-5-2-6-12-21/h2-17,24-28H,18-19H2,1H3/t24-,25-,26+,27+,28-/m1/s1 |
| InChIKey | GYIWKVGAQVYKSX-URYJJRPLSA-N |
| XLogP | 4.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|