C19H24O7 — CID 10737487
methyl (2R,4E,6R)-4-(2-methoxy-2-oxoethylidene)-6-[(4-methoxyphenyl)methoxymethyl]oxane-2-carboxylate (PubChem CID 10737487) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is methyl (2R,4E,6R)-4-(2-methoxy-2-oxoethylidene)-6-[(4-methoxyphenyl)methoxymethyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4E,6R)-4-(2-methoxy-2-oxoethylidene)-6-[(4-methoxyphenyl)methoxymethyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10737487 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl (2R,4E,6R)-4-(2-methoxy-2-oxoethylidene)-6-[(4-methoxyphenyl)methoxymethyl]oxane-2-carboxylate |
| SMILES | COC(=O)/C=C1\C[C@H](COCc2ccc(OC)cc2)O[C@@H](C(=O)OC)C1 |
| InChI | InChI=1S/C19H24O7/c1-22-15-6-4-13(5-7-15)11-25-12-16-8-14(10-18(20)23-2)9-17(26-16)19(21)24-3/h4-7,10,16-17H,8-9,11-12H2,1-3H3/b14-10+/t16-,17-/m1/s1 |
| InChIKey | FVJIAZFSUKYFCR-PNUWANSTSA-N |
| XLogP | 2.03 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|