C25H34O6 — CID 163099811
5-[(2S,4R,6R)-4-hydroxy-6-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]oxan-2-yl]-3-methoxybenzene-1,2-diol (PubChem CID 163099811) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 5-[(2S,4R,6R)-4-hydroxy-6-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]oxan-2-yl]-3-methoxybenzene-1,2-diol.
| Compound Name | 5-[(2S,4R,6R)-4-hydroxy-6-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]oxan-2-yl]-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 163099811 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 5-[(2S,4R,6R)-4-hydroxy-6-[2-[4-hydroxy-3-(3-methylbutyl)phenyl]ethyl]oxan-2-yl]-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc([C@@H]2C[C@H](O)C[C@@H](CCc3ccc(O)c(CCC(C)C)c3)O2)cc(O)c1O |
| InChI | InChI=1S/C25H34O6/c1-15(2)4-7-17-10-16(6-9-21(17)27)5-8-20-13-19(26)14-23(31-20)18-11-22(28)25(29)24(12-18)30-3/h6,9-12,15,19-20,23,26-29H,4-5,7-8,13-14H2,1-3H3/t19-,20-,23+/m1/s1 |
| InChIKey | GDRIYSAPVTZOPJ-VIZSFHNOSA-N |
| XLogP | 4.61 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|