C27H34O8 — CID 162830870
[(2S,4R,6S)-2-(3-cyclopentyloxy-4,5-dihydroxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate (PubChem CID 162830870) has the molecular formula C27H34O8 and a molecular weight of 486.56 g/mol. Its IUPAC name is [(2S,4R,6S)-2-(3-cyclopentyloxy-4,5-dihydroxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate.
| Compound Name | [(2S,4R,6S)-2-(3-cyclopentyloxy-4,5-dihydroxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 162830870 |
| Molecular Formula | C27H34O8 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | [(2S,4R,6S)-2-(3-cyclopentyloxy-4,5-dihydroxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate |
| SMILES | COc1cc(CC[C@H]2C[C@@H](OC(C)=O)C[C@@H](c3cc(O)c(O)c(OC4CCCC4)c3)O2)ccc1O |
| InChI | InChI=1S/C27H34O8/c1-16(28)33-21-14-20(9-7-17-8-10-22(29)25(11-17)32-2)35-24(15-21)18-12-23(30)27(31)26(13-18)34-19-5-3-4-6-19/h8,10-13,19-21,24,29-31H,3-7,9,14-15H2,1-2H3/t20-,21+,24-/m0/s1 |
| InChIKey | KDRVFDQLTPBYHV-IMSXRSKXSA-N |
| XLogP | 4.92 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|