C30H38O9 — CID 163084458
[(2S,4S,6S)-2-[3,4-dihydroxy-5-[4-(2-oxoethyl)cyclohexyl]oxyphenyl]-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate (PubChem CID 163084458) has the molecular formula C30H38O9 and a molecular weight of 542.63 g/mol. Its IUPAC name is [(2S,4S,6S)-2-[3,4-dihydroxy-5-[4-(2-oxoethyl)cyclohexyl]oxyphenyl]-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate.
| Compound Name | [(2S,4S,6S)-2-[3,4-dihydroxy-5-[4-(2-oxoethyl)cyclohexyl]oxyphenyl]-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 163084458 |
| Molecular Formula | C30H38O9 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | [(2S,4S,6S)-2-[3,4-dihydroxy-5-[4-(2-oxoethyl)cyclohexyl]oxyphenyl]-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate |
| SMILES | COc1cc(CC[C@H]2C[C@H](OC(C)=O)C[C@@H](c3cc(O)c(O)c(OC4CCC(CC=O)CC4)c3)O2)ccc1O |
| InChI | InChI=1S/C30H38O9/c1-18(32)37-24-16-23(9-5-20-6-10-25(33)28(13-20)36-2)39-27(17-24)21-14-26(34)30(35)29(15-21)38-22-7-3-19(4-8-22)11-12-31/h6,10,12-15,19,22-24,27,33-35H,3-5,7-9,11,16-17H2,1-2H3/t19?,22?,23-,24-,27-/m0/s1 |
| InChIKey | GJFLPBGNLPXCPD-KZSHBQMTSA-N |
| XLogP | 5.12 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|