C36H50O8 — CID 163064638
[(2S,4R,6S)-2-[3,4-dihydroxy-5-[(3S)-spiro[4.4]nonan-3-yl]oxyphenyl]-6-[(2R)-1-(4-hydroxy-3-methoxyphenyl)heptan-2-yl]oxan-4-yl] acetate (PubChem CID 163064638) has the molecular formula C36H50O8 and a molecular weight of 610.79 g/mol. Its IUPAC name is [(2S,4R,6S)-2-[3,4-dihydroxy-5-[(3S)-spiro[4.4]nonan-3-yl]oxyphenyl]-6-[(2R)-1-(4-hydroxy-3-methoxyphenyl)heptan-2-yl]oxan-4-yl] acetate.
| Compound Name | [(2S,4R,6S)-2-[3,4-dihydroxy-5-[(3S)-spiro[4.4]nonan-3-yl]oxyphenyl]-6-[(2R)-1-(4-hydroxy-3-methoxyphenyl)heptan-2-yl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 163064638 |
| Molecular Formula | C36H50O8 |
| Molecular Weight | 610.79 g/mol |
| Exact Mass | 610.35 |
| IUPAC Name | [(2S,4R,6S)-2-[3,4-dihydroxy-5-[(3S)-spiro[4.4]nonan-3-yl]oxyphenyl]-6-[(2R)-1-(4-hydroxy-3-methoxyphenyl)heptan-2-yl]oxan-4-yl] acetate |
| SMILES | CCCCC[C@H](Cc1ccc(O)c(OC)c1)[C@@H]1C[C@@H](OC(C)=O)C[C@@H](c2cc(O)c(O)c(O[C@H]3CCC4(CCCC4)C3)c2)O1 |
| InChI | InChI=1S/C36H50O8/c1-4-5-6-9-25(16-24-10-11-29(38)33(17-24)41-3)31-20-28(42-23(2)37)21-32(44-31)26-18-30(39)35(40)34(19-26)43-27-12-15-36(22-27)13-7-8-14-36/h10-11,17-19,25,27-28,31-32,38-40H,4-9,12-16,20-22H2,1-3H3/t25-,27+,28-,31+,32+/m1/s1 |
| InChIKey | KNJVBEGUJATRJI-XIOOKUSHSA-N |
| XLogP | 7.89 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.79 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|