C31H40O8 — CID 162826908
[2-(3,4-dihydroxy-5-spiro[4.4]nonan-3-yloxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate (PubChem CID 162826908) has the molecular formula C31H40O8 and a molecular weight of 540.65 g/mol. Its IUPAC name is [2-(3,4-dihydroxy-5-spiro[4.4]nonan-3-yloxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate.
| Compound Name | [2-(3,4-dihydroxy-5-spiro[4.4]nonan-3-yloxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate |
|---|---|
| PubChem CID | 162826908 |
| Molecular Formula | C31H40O8 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | [2-(3,4-dihydroxy-5-spiro[4.4]nonan-3-yloxyphenyl)-6-[2-(4-hydroxy-3-methoxyphenyl)ethyl]oxan-4-yl] acetate |
| SMILES | COc1cc(CCC2CC(OC(C)=O)CC(c3cc(O)c(O)c(OC4CCC5(CCCC5)C4)c3)O2)ccc1O |
| InChI | InChI=1S/C31H40O8/c1-19(32)37-24-16-22(7-5-20-6-8-25(33)28(13-20)36-2)38-27(17-24)21-14-26(34)30(35)29(15-21)39-23-9-12-31(18-23)10-3-4-11-31/h6,8,13-15,22-24,27,33-35H,3-5,7,9-12,16-18H2,1-2H3 |
| InChIKey | ZWLTZLYHYTYMKM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|