C19H28O4 — CID 163096599
(E,6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodec-4-en-3-one (PubChem CID 163096599) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (E,6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodec-4-en-3-one.
| Compound Name | (E,6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodec-4-en-3-one |
|---|---|
| PubChem CID | 163096599 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (E,6R)-6-hydroxy-1-(4-hydroxy-3-methoxyphenyl)dodec-4-en-3-one |
| SMILES | CCCCCC[C@@H](O)/C=C/C(=O)CCc1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C19H28O4/c1-3-4-5-6-7-16(20)11-12-17(21)10-8-15-9-13-18(22)19(14-15)23-2/h9,11-14,16,20,22H,3-8,10H2,1-2H3/b12-11+/t16-/m1/s1 |
| InChIKey | SPNZMFIZAHJVFR-LPQFERQCSA-N |
| XLogP | 3.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|