C22H34O3 — CID 162992175
(6S)-6-butyl-1-(4-hydroxy-3-methoxyphenyl)-9-methyldec-4-en-3-one (PubChem CID 162992175) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is (6S)-6-butyl-1-(4-hydroxy-3-methoxyphenyl)-9-methyldec-4-en-3-one.
| Compound Name | (6S)-6-butyl-1-(4-hydroxy-3-methoxyphenyl)-9-methyldec-4-en-3-one |
|---|---|
| PubChem CID | 162992175 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | (6S)-6-butyl-1-(4-hydroxy-3-methoxyphenyl)-9-methyldec-4-en-3-one |
| SMILES | CCCC[C@H](C=CC(=O)CCc1ccc(O)c(OC)c1)CCC(C)C |
| InChI | InChI=1S/C22H34O3/c1-5-6-7-18(9-8-17(2)3)10-13-20(23)14-11-19-12-15-21(24)22(16-19)25-4/h10,12-13,15-18,24H,5-9,11,14H2,1-4H3/t18-/m0/s1 |
| InChIKey | BTRGLLIVOOMALO-SFHVURJKSA-N |
| XLogP | 5.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|