C30H44N4O5 — CID 162838189
1-[2-hydroxy-5-[(2S)-7-(4-hydroxy-3-methoxyphenyl)-5-oxo-2-pentylhept-3-enyl]-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine (PubChem CID 162838189) has the molecular formula C30H44N4O5 and a molecular weight of 540.71 g/mol. Its IUPAC name is 1-[2-hydroxy-5-[(2S)-7-(4-hydroxy-3-methoxyphenyl)-5-oxo-2-pentylhept-3-enyl]-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine.
| Compound Name | 1-[2-hydroxy-5-[(2S)-7-(4-hydroxy-3-methoxyphenyl)-5-oxo-2-pentylhept-3-enyl]-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine |
|---|---|
| PubChem CID | 162838189 |
| Molecular Formula | C30H44N4O5 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | 1-[2-hydroxy-5-[(2S)-7-(4-hydroxy-3-methoxyphenyl)-5-oxo-2-pentylhept-3-enyl]-3-[2-(methylamino)ethoxy]phenyl]-2-methylguanidine |
| SMILES | CCCCC[C@H](C=CC(=O)CCc1ccc(O)c(OC)c1)Cc1cc(N/C(N)=N/C)c(O)c(OCCNC)c1 |
| InChI | InChI=1S/C30H44N4O5/c1-5-6-7-8-21(9-12-24(35)13-10-22-11-14-26(36)27(19-22)38-4)17-23-18-25(34-30(31)33-3)29(37)28(20-23)39-16-15-32-2/h9,11-12,14,18-21,32,36-37H,5-8,10,13,15-17H2,1-4H3,(H3,31,33,34)/t21-/m1/s1 |
| InChIKey | ZNCRKCHZEFILDK-OAQYLSRUSA-N |
| XLogP | 4.56 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|